C16H30O5Si — CID 164606422
(4aR,8R,8aS)-2,2-ditert-butyl-8-(methoxymethoxy)-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline (PubChem CID 164606422) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (4aR,8R,8aS)-2,2-ditert-butyl-8-(methoxymethoxy)-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,8R,8aS)-2,2-ditert-butyl-8-(methoxymethoxy)-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 164606422 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (4aR,8R,8aS)-2,2-ditert-butyl-8-(methoxymethoxy)-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
| SMILES | COCO[C@@H]1C=CO[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C16H30O5Si/c1-15(2,3)22(16(4,5)6)20-10-13-14(21-22)12(8-9-18-13)19-11-17-7/h8-9,12-14H,10-11H2,1-7H3/t12-,13-,14+/m1/s1 |
| InChIKey | GWNKTIZQDHNJKQ-MCIONIFRSA-N |
| XLogP | 3.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|