C26H21F2N3O4S — CID 164607591
(1S,13Z)-19,20-difluoro-7-hydroxy-16-oxa-23-thia-2,3,10-triazahexacyclo[15.12.1.12,10.03,8.021,30.024,29]hentriaconta-4,7,13,17,19,21(30),24,26,28-nonaene-6,9-dione (PubChem CID 164607591) has the molecular formula C26H21F2N3O4S and a molecular weight of 509.53 g/mol. Its IUPAC name is (1S,13Z)-19,20-difluoro-7-hydroxy-16-oxa-23-thia-2,3,10-triazahexacyclo[15.12.1.12,10.03,8.021,30.024,29]hentriaconta-4,7,13,17,19,21(30),24,26,28-nonaene-6,9-dione.
| Compound Name | (1S,13Z)-19,20-difluoro-7-hydroxy-16-oxa-23-thia-2,3,10-triazahexacyclo[15.12.1.12,10.03,8.021,30.024,29]hentriaconta-4,7,13,17,19,21(30),24,26,28-nonaene-6,9-dione |
|---|---|
| PubChem CID | 164607591 |
| Molecular Formula | C26H21F2N3O4S |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (1S,13Z)-19,20-difluoro-7-hydroxy-16-oxa-23-thia-2,3,10-triazahexacyclo[15.12.1.12,10.03,8.021,30.024,29]hentriaconta-4,7,13,17,19,21(30),24,26,28-nonaene-6,9-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1CC/C=C\COc1cc(F)c(F)c3c1[C@H]2c1ccccc1SC3 |
| InChI | InChI=1S/C26H21F2N3O4S/c27-17-12-19-21-16(22(17)28)13-36-20-7-3-2-6-15(20)23(21)31-14-29(9-4-1-5-11-35-19)26(34)24-25(33)18(32)8-10-30(24)31/h1-3,5-8,10,12,23,33H,4,9,11,13-14H2/b5-1-/t23-/m1/s1 |
| InChIKey | INMSBPFQFIYQGK-HWBQDGEDSA-N |
| XLogP | 3.92 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|