C28H24FN3O4S — CID 164607665
(1S,12E)-18-fluoro-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclobutane]-6,9-dione (PubChem CID 164607665) has the molecular formula C28H24FN3O4S and a molecular weight of 517.58 g/mol. Its IUPAC name is (1S,12E)-18-fluoro-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclobutane]-6,9-dione.
| Compound Name | (1S,12E)-18-fluoro-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclobutane]-6,9-dione |
|---|---|
| PubChem CID | 164607665 |
| Molecular Formula | C28H24FN3O4S |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (1S,12E)-18-fluoro-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclobutane]-6,9-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C1(/C=C\COc3cc(F)cc4c3[C@H]2c2ccccc2SC4)CCC1 |
| InChI | InChI=1S/C28H24FN3O4S/c29-18-13-17-15-37-22-6-2-1-5-19(22)24-23(17)21(14-18)36-12-4-10-28(8-3-9-28)30-16-32(24)31-11-7-20(33)26(34)25(31)27(30)35/h1-2,4-7,10-11,13-14,24,34H,3,8-9,12,15-16H2/b10-4-/t24-/m1/s1 |
| InChIKey | CGAUUUUORWATJY-ZNMCKTMUSA-N |
| XLogP | 4.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|