C28H28F4N4O4 — CID 164607866
N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide (PubChem CID 164607866) has the molecular formula C28H28F4N4O4 and a molecular weight of 560.55 g/mol. Its IUPAC name is N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide.
| Compound Name | N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164607866 |
| Molecular Formula | C28H28F4N4O4 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3ccc4c(c3)OCCO4)cc2NC(=O)C2C=NC(=O)C=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C28H28F4N4O4/c1-15-13-36(14-16(2)35(15)3)23-11-21(29)18(17-4-5-24-25(8-17)40-7-6-39-24)9-22(23)34-27(38)19-12-33-26(37)10-20(19)28(30,31)32/h4-5,8-12,15-16,19H,6-7,13-14H2,1-3H3,(H,34,38)/t15-,16+,19? |
| InChIKey | RGORAVZUHUBMNQ-MCPYQZEQSA-N |
| XLogP | 4.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |