C29H34ClF4N7O2 — CID 164607983
N-[5-[1-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 164607983) has the molecular formula C29H34ClF4N7O2 and a molecular weight of 624.08 g/mol. Its IUPAC name is N-[5-[1-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[5-[1-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164607983 |
| Molecular Formula | C29H34ClF4N7O2 |
| Molecular Weight | 624.08 g/mol |
| Exact Mass | 623.24 |
| IUPAC Name | N-[5-[1-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCN(c4ncc(Cl)cn4)CC3)cc2NC(=O)C2CNC(=O)CC2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H34ClF4N7O2/c1-16-14-41(15-17(2)39(16)3)25-10-23(31)20(18-4-6-40(7-5-18)28-36-11-19(30)12-37-28)8-24(25)38-27(43)21-13-35-26(42)9-22(21)29(32,33)34/h4,8,10-12,16-17,21-22H,5-7,9,13-15H2,1-3H3,(H,35,42)(H,38,43)/t16-,17+,21?,22? |
| InChIKey | NBDDSRZOJVDQDW-RGMRCXJASA-N |
| XLogP | 4.34 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|