C31H37F4N5O4 — CID 164608097
(1-methylcyclobutyl) 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 164608097) has the molecular formula C31H37F4N5O4 and a molecular weight of 619.66 g/mol. Its IUPAC name is (1-methylcyclobutyl) 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | (1-methylcyclobutyl) 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164608097 |
| Molecular Formula | C31H37F4N5O4 |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | (1-methylcyclobutyl) 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(C(=O)OC4(C)CCC4)C3)cc2NC(=O)C2C=NC(=O)C=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C31H37F4N5O4/c1-18-15-40(16-19(2)38(18)4)26-13-24(32)21(20-7-5-10-39(17-20)29(43)44-30(3)8-6-9-30)11-25(26)37-28(42)22-14-36-27(41)12-23(22)31(33,34)35/h7,11-14,18-19,22H,5-6,8-10,15-17H2,1-4H3,(H,37,42)/t18-,19+,22? |
| InChIKey | MXFDPNUDWXYGRH-QIDMFYOTSA-N |
| XLogP | 5.18 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|