C31H38F3N5O4 — CID 164608203
(1-methylcyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-3H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 164608203) has the molecular formula C31H38F3N5O4 and a molecular weight of 601.67 g/mol. Its IUPAC name is (1-methylcyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-3H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | (1-methylcyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-3H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164608203 |
| Molecular Formula | C31H38F3N5O4 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | (1-methylcyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-3H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCN(C(=O)OC4(C)CCC4)CC3)cc2NC(=O)C2C=NC(=O)C=C2C(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C31H38F3N5O4/c1-18-16-39(17-19(2)37(18)4)26-14-24(32)21(20-6-10-38(11-7-20)30(42)43-31(3)8-5-9-31)12-25(26)36-29(41)23-15-35-27(40)13-22(23)28(33)34/h6,12-15,18-19,23,28H,5,7-11,16-17H2,1-4H3,(H,36,41)/t18-,19+,23? |
| InChIKey | HILTUZDHPILHEH-LIMIJEPZSA-N |
| XLogP | 4.88 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|