C34H41F6N5O3 — CID 164608260
N-[5-[4-[cyclohexyl(methyl)carbamoyl]-3,5-difluorophenyl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 164608260) has the molecular formula C34H41F6N5O3 and a molecular weight of 681.72 g/mol. Its IUPAC name is N-[5-[4-[cyclohexyl(methyl)carbamoyl]-3,5-difluorophenyl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[5-[4-[cyclohexyl(methyl)carbamoyl]-3,5-difluorophenyl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164608260 |
| Molecular Formula | C34H41F6N5O3 |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | N-[5-[4-[cyclohexyl(methyl)carbamoyl]-3,5-difluorophenyl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3cc(F)c(C(=O)N(C)C4CCCCC4)c(F)c3)cc2NC(=O)C2CNC(=O)CC2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C34H41F6N5O3/c1-18-16-45(17-19(2)43(18)3)29-14-25(35)22(12-28(29)42-32(47)23-15-41-30(46)13-24(23)34(38,39)40)20-10-26(36)31(27(37)11-20)33(48)44(4)21-8-6-5-7-9-21/h10-12,14,18-19,21,23-24H,5-9,13,15-17H2,1-4H3,(H,41,46)(H,42,47)/t18-,19+,23?,24? |
| InChIKey | HROAODVHKBITGB-LHHMWQFHSA-N |
| XLogP | 5.96 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |