About 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine
3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine (PubChem CID 164608415) has the molecular formula C14H16F3N3O
and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine |
| PubChem CID | 164608415 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine |
| SMILES | NCCCn1cc(-c2ccccc2OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)10-21-13-5-2-1-4-12(13)11-8-19-20(9-11)7-3-6-18/h1-2,4-5,8-9H,3,6-7,10,18H2 |
| InChIKey | ORZJVUCVQJEBTK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine?
The IUPAC name of 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine (CID 164608415) is 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine.
What is the SMILES notation for 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine?
The canonical SMILES for 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine is NCCCn1cc(-c2ccccc2OCC(F)(F)F)cn1.
What is the InChIKey of 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine?
The InChIKey is ORZJVUCVQJEBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3O/c15-14(16,17)10-21-13-5-2-1-4-12(13)11-8-19-20(9-11)7-3-6-18/h1-2,4-5,8-9H,3,6-7,10,18H2.
What are the key properties of 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine?
3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine has a molecular weight of 299.30 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine is sourced from PubChem (CID 164608415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).