C14H16F3N3O — CID 164608415
3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine (PubChem CID 164608415) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine.
| Compound Name | 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 164608415 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]pyrazol-1-yl]propan-1-amine |
| SMILES | NCCCn1cc(-c2ccccc2OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)10-21-13-5-2-1-4-12(13)11-8-19-20(9-11)7-3-6-18/h1-2,4-5,8-9H,3,6-7,10,18H2 |
| InChIKey | ORZJVUCVQJEBTK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |