C12H19NO7 — CID 164608568
4-(4-carboxy-3-hydroxybutan-2-yl)-3-(carboxymethyl)pyrrolidine-2-carboxylic acid (PubChem CID 164608568) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-(4-carboxy-3-hydroxybutan-2-yl)-3-(carboxymethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-(4-carboxy-3-hydroxybutan-2-yl)-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 164608568 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-(4-carboxy-3-hydroxybutan-2-yl)-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C(O)CC(=O)O)C1CNC(C(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C12H19NO7/c1-5(8(14)3-10(17)18)7-4-13-11(12(19)20)6(7)2-9(15)16/h5-8,11,13-14H,2-4H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | QRPLWCDTVQJWLX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |