C27H18N4O4S — CID 164608696
8-[[2-amino-4-(2-hydroxyphenyl)pyrimidin-5-yl]methyl]-3-(1,3-benzothiazol-2-yl)-7-hydroxychromen-2-one (PubChem CID 164608696) has the molecular formula C27H18N4O4S and a molecular weight of 494.53 g/mol. Its IUPAC name is 8-[[2-amino-4-(2-hydroxyphenyl)pyrimidin-5-yl]methyl]-3-(1,3-benzothiazol-2-yl)-7-hydroxychromen-2-one.
| Compound Name | 8-[[2-amino-4-(2-hydroxyphenyl)pyrimidin-5-yl]methyl]-3-(1,3-benzothiazol-2-yl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 164608696 |
| Molecular Formula | C27H18N4O4S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 8-[[2-amino-4-(2-hydroxyphenyl)pyrimidin-5-yl]methyl]-3-(1,3-benzothiazol-2-yl)-7-hydroxychromen-2-one |
| SMILES | Nc1ncc(Cc2c(O)ccc3cc(-c4nc5ccccc5s4)c(=O)oc23)c(-c2ccccc2O)n1 |
| InChI | InChI=1S/C27H18N4O4S/c28-27-29-13-15(23(31-27)16-5-1-3-7-20(16)32)12-17-21(33)10-9-14-11-18(26(34)35-24(14)17)25-30-19-6-2-4-8-22(19)36-25/h1-11,13,32-33H,12H2,(H2,28,29,31) |
| InChIKey | NSHVEFXEOSYHRB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|