C17H13FN4O2 — CID 164608771
4-(4-fluorophenyl)-2,5-dioxo-3,7,8,9-tetrahydro-1H-[1,4]diazepino[5,6-b]pyrrolizine-10-carbonitrile (PubChem CID 164608771) has the molecular formula C17H13FN4O2 and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,5-dioxo-3,7,8,9-tetrahydro-1H-[1,4]diazepino[5,6-b]pyrrolizine-10-carbonitrile.
| Compound Name | 4-(4-fluorophenyl)-2,5-dioxo-3,7,8,9-tetrahydro-1H-[1,4]diazepino[5,6-b]pyrrolizine-10-carbonitrile |
|---|---|
| PubChem CID | 164608771 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-(4-fluorophenyl)-2,5-dioxo-3,7,8,9-tetrahydro-1H-[1,4]diazepino[5,6-b]pyrrolizine-10-carbonitrile |
| SMILES | N#Cc1c2c(n3c1CCC3)C(=O)N(c1ccc(F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C17H13FN4O2/c18-10-3-5-11(6-4-10)22-9-14(23)20-15-12(8-19)13-2-1-7-21(13)16(15)17(22)24/h3-6H,1-2,7,9H2,(H,20,23) |
| InChIKey | KIQVFTOGDITNPZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |