About 3-purin-9-yloctan-1-ol
3-purin-9-yloctan-1-ol (PubChem CID 164608909) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-purin-9-yloctan-1-ol.
Molecular Properties
| Compound Name | 3-purin-9-yloctan-1-ol |
| PubChem CID | 164608909 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3-purin-9-yloctan-1-ol |
| SMILES | CCCCCC(CCO)n1cnc2cncnc21 |
| InChI | InChI=1S/C13H20N4O/c1-2-3-4-5-11(6-7-18)17-10-16-12-8-14-9-15-13(12)17/h8-11,18H,2-7H2,1H3 |
| InChIKey | LGZJEFMPIOUQTE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-purin-9-yloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-purin-9-yloctan-1-ol?
The IUPAC name of 3-purin-9-yloctan-1-ol (CID 164608909) is 3-purin-9-yloctan-1-ol.
What is the SMILES notation for 3-purin-9-yloctan-1-ol?
The canonical SMILES for 3-purin-9-yloctan-1-ol is CCCCCC(CCO)n1cnc2cncnc21.
What is the InChIKey of 3-purin-9-yloctan-1-ol?
The InChIKey is LGZJEFMPIOUQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-2-3-4-5-11(6-7-18)17-10-16-12-8-14-9-15-13(12)17/h8-11,18H,2-7H2,1H3.
What are the key properties of 3-purin-9-yloctan-1-ol?
3-purin-9-yloctan-1-ol has a molecular weight of 248.33 g/mol, XLogP of 2.33, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-purin-9-yloctan-1-ol is sourced from PubChem (CID 164608909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).