C32H38N8O4 — CID 164608977
[2-[3-amino-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 164608977) has the molecular formula C32H38N8O4 and a molecular weight of 598.71 g/mol. Its IUPAC name is [2-[3-amino-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[3-amino-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164608977 |
| Molecular Formula | C32H38N8O4 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | [2-[3-amino-4-(4-methylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(N)c3)nc3c2ccn3COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C32H38N8O4/c1-6-27(41)34-21-8-7-9-23(18-21)44-29-24-12-13-40(20-43-30(42)32(2,3)4)28(24)36-31(37-29)35-22-10-11-26(25(33)19-22)39-16-14-38(5)15-17-39/h6-13,18-19H,1,14-17,20,33H2,2-5H3,(H,34,41)(H,35,36,37) |
| InChIKey | BSKIDONSSOJYMR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|