C16H10Br2N6S2 — CID 164609024
5-(2-bromophenyl)-3-[[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole (PubChem CID 164609024) has the molecular formula C16H10Br2N6S2 and a molecular weight of 510.24 g/mol. Its IUPAC name is 5-(2-bromophenyl)-3-[[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(2-bromophenyl)-3-[[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 164609024 |
| Molecular Formula | C16H10Br2N6S2 |
| Molecular Weight | 510.24 g/mol |
| Exact Mass | 507.88 |
| IUPAC Name | 5-(2-bromophenyl)-3-[[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
| SMILES | Brc1ccccc1-c1nc(SSc2n[nH]c(-c3ccccc3Br)n2)n[nH]1 |
| InChI | InChI=1S/C16H10Br2N6S2/c17-11-7-3-1-5-9(11)13-19-15(23-21-13)25-26-16-20-14(22-24-16)10-6-2-4-8-12(10)18/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChIKey | KSGXBWCWQZKFTG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.24 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|