C12H12FN5O4 — CID 164609028
(2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 164609028) has the molecular formula C12H12FN5O4 and a molecular weight of 309.26 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 164609028 |
| Molecular Formula | C12H12FN5O4 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(c2cc(F)c3c(N)ncnn23)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H12FN5O4/c13-5-1-7(18-8(5)11(15)16-4-17-18)12(3-14)10(21)9(20)6(2-19)22-12/h1,4,6,9-10,19-21H,2H2,(H2,15,16,17)/t6-,9-,10-,12+/m1/s1 |
| InChIKey | RYLKQJCHLRWMDB-CWLXEDRGSA-N |
| XLogP | -1.72 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |