About 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide
4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 164609106) has the molecular formula C18H17ClN2O3
and a molecular weight of 344.80 g/mol. Its IUPAC name is 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide |
| PubChem CID | 164609106 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)CCCc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-15-8-9-16-14(10-15)2-1-3-17(22)21(16)11-12-4-6-13(7-5-12)18(23)20-24/h4-10,24H,1-3,11H2,(H,20,23) |
| InChIKey | MJRAWABZLHXTMT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide (CID 164609106) is 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(CN2C(=O)CCCc3cc(Cl)ccc32)cc1.
What is the InChIKey of 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide?
The InChIKey is MJRAWABZLHXTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O3/c19-15-8-9-16-14(10-15)2-1-3-17(22)21(16)11-12-4-6-13(7-5-12)18(23)20-24/h4-10,24H,1-3,11H2,(H,20,23).
What are the key properties of 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide?
4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide has a molecular weight of 344.80 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-chloro-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 164609106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).