C15H21N3O8 — CID 164609116
[(2R,3S,6S)-3-acetyloxy-6-[(2R)-2-acetyloxy-3-azidopropoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 164609116) has the molecular formula C15H21N3O8 and a molecular weight of 371.35 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[(2R)-2-acetyloxy-3-azidopropoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[(2R)-2-acetyloxy-3-azidopropoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164609116 |
| Molecular Formula | C15H21N3O8 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[(2R)-2-acetyloxy-3-azidopropoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@@H](CN=[N+]=[N-])OC(C)=O)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21N3O8/c1-9(19)22-8-14-13(25-11(3)21)4-5-15(26-14)23-7-12(6-17-18-16)24-10(2)20/h4-5,12-15H,6-8H2,1-3H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | BTOZNEZFMYEHKM-BARDWOONSA-N |
| XLogP | 1.02 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|