About 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide
1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide (PubChem CID 164609124) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide |
| PubChem CID | 164609124 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide |
| SMILES | O=C(NO)c1cccc(C(=O)NOCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C19H16N2O4/c22-18(20-24)14-7-4-8-15(11-14)19(23)21-25-12-16-9-3-6-13-5-1-2-10-17(13)16/h1-11,24H,12H2,(H,20,22)(H,21,23) |
| InChIKey | KDOJJXCRYYLTSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide?
The IUPAC name of 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide (CID 164609124) is 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide is O=C(NO)c1cccc(C(=O)NOCc2cccc3ccccc23)c1.
What is the InChIKey of 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide?
The InChIKey is KDOJJXCRYYLTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c22-18(20-24)14-7-4-8-15(11-14)19(23)21-25-12-16-9-3-6-13-5-1-2-10-17(13)16/h1-11,24H,12H2,(H,20,22)(H,21,23).
What are the key properties of 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide?
1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide has a molecular weight of 336.35 g/mol, XLogP of 2.82, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-hydroxy-3-N-(naphthalen-1-ylmethoxy)benzene-1,3-dicarboxamide is sourced from PubChem (CID 164609124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).