C23H24N4O2S — CID 164609187
N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]acetamide (PubChem CID 164609187) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 164609187 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cnc(C(=O)N2CCc3c(-c4ccccc4)cccc32)s1 |
| InChI | InChI=1S/C23H24N4O2S/c1-16(28)25-12-11-24-14-18-15-26-22(30-18)23(29)27-13-10-20-19(8-5-9-21(20)27)17-6-3-2-4-7-17/h2-9,15,24H,10-14H2,1H3,(H,25,28) |
| InChIKey | SFSDZOCTOZPGGG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|