C23H37NO2 — CID 164609221
(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-N-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 164609221) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-N-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-N-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 164609221 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-N-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H37NO2/c1-14(2)24-21(26)20-8-7-18-17-6-5-15-13-16(25)9-11-22(15,3)19(17)10-12-23(18,20)4/h5,14,16-20,25H,6-13H2,1-4H3,(H,24,26)/t16-,17-,18-,19-,20+,22-,23-/m0/s1 |
| InChIKey | PZCYCVDGVOPKEK-MTMZYOSNSA-N |
| XLogP | 4.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|