C12H26ClNO4 — CID 164609572
(2S,3R,4R,5S)-2-hexyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (PubChem CID 164609572) has the molecular formula C12H26ClNO4 and a molecular weight of 283.80 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-hexyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride.
| Compound Name | (2S,3R,4R,5S)-2-hexyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 164609572 |
| Molecular Formula | C12H26ClNO4 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S,3R,4R,5S)-2-hexyl-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| SMILES | CCCCCC[C@@]1(CO)NC[C@H](O)[C@@H](O)[C@@H]1O.Cl |
| InChI | InChI=1S/C12H25NO4.ClH/c1-2-3-4-5-6-12(8-14)11(17)10(16)9(15)7-13-12;/h9-11,13-17H,2-8H2,1H3;1H/t9-,10+,11-,12-;/m0./s1 |
| InChIKey | WVMDBISTNBNDSL-WWYGBNOYSA-N |
| XLogP | -0.20 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|