About 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride
2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride (PubChem CID 164609682) has the molecular formula C27H27ClN2
and a molecular weight of 414.98 g/mol. Its IUPAC name is 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride.
Molecular Properties
| Compound Name | 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride |
| PubChem CID | 164609682 |
| Molecular Formula | C27H27ClN2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride |
| SMILES | CCCCn1ccc2ccc(-c3ccc4c(c3)c3c(C)cccc3c[n+]4C)cc21.[Cl-] |
| InChI | InChI=1S/C27H27N2.ClH/c1-4-5-14-29-15-13-20-9-10-22(17-26(20)29)21-11-12-25-24(16-21)27-19(2)7-6-8-23(27)18-28(25)3;/h6-13,15-18H,4-5,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | SVMSRRWTLKYACA-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride?
The IUPAC name of 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride (CID 164609682) is 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride.
What is the SMILES notation for 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride?
The canonical SMILES for 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride is CCCCn1ccc2ccc(-c3ccc4c(c3)c3c(C)cccc3c[n+]4C)cc21.[Cl-].
What is the InChIKey of 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride?
The InChIKey is SVMSRRWTLKYACA-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H27N2.ClH/c1-4-5-14-29-15-13-20-9-10-22(17-26(20)29)21-11-12-25-24(16-21)27-19(2)7-6-8-23(27)18-28(25)3;/h6-13,15-18H,4-5,14H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride?
2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride has a molecular weight of 414.98 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butylindol-6-yl)-5,10-dimethylphenanthridin-5-ium chloride is sourced from PubChem (CID 164609682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).