C17H24N6OS — CID 164609729
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 164609729) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 164609729 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | Cc1nc(N)sc1CCC/N=C(\N)NC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H24N6OS/c1-11(13-7-4-3-5-8-13)22-17(24)23-15(18)20-10-6-9-14-12(2)21-16(19)25-14/h3-5,7-8,11H,6,9-10H2,1-2H3,(H2,19,21)(H4,18,20,22,23,24)/t11-/m1/s1 |
| InChIKey | QTIAXUAWMLBIGP-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|