C23H27N5O3 — CID 164609744
3-(1-methyltriazol-4-yl)-N-(oxan-4-ylmethyl)-4-[(1S)-1-pyridin-2-ylethoxy]benzamide (PubChem CID 164609744) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-(1-methyltriazol-4-yl)-N-(oxan-4-ylmethyl)-4-[(1S)-1-pyridin-2-ylethoxy]benzamide.
| Compound Name | 3-(1-methyltriazol-4-yl)-N-(oxan-4-ylmethyl)-4-[(1S)-1-pyridin-2-ylethoxy]benzamide |
|---|---|
| PubChem CID | 164609744 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-(1-methyltriazol-4-yl)-N-(oxan-4-ylmethyl)-4-[(1S)-1-pyridin-2-ylethoxy]benzamide |
| SMILES | C[C@H](Oc1ccc(C(=O)NCC2CCOCC2)cc1-c1cn(C)nn1)c1ccccn1 |
| InChI | InChI=1S/C23H27N5O3/c1-16(20-5-3-4-10-24-20)31-22-7-6-18(13-19(22)21-15-28(2)27-26-21)23(29)25-14-17-8-11-30-12-9-17/h3-7,10,13,15-17H,8-9,11-12,14H2,1-2H3,(H,25,29)/t16-/m0/s1 |
| InChIKey | UYDJMSNAHOLOGV-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |