C29H35N3O5 — CID 164610125
6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]hexanoic acid (PubChem CID 164610125) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 164610125 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)[C@H](c1ccc(CN2N=C(c3ccccc3)OCC2=O)cc1)C1CCCC1 |
| InChI | InChI=1S/C29H35N3O5/c33-25-20-37-29(24-11-3-1-4-12-24)31-32(25)19-21-14-16-23(17-15-21)27(22-9-6-7-10-22)28(36)30-18-8-2-5-13-26(34)35/h1,3-4,11-12,14-17,22,27H,2,5-10,13,18-20H2,(H,30,36)(H,34,35)/t27-/m0/s1 |
| InChIKey | PLSWVKIURPZEOK-MHZLTWQESA-N |
| XLogP | 4.44 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|