C19H20ClN3O2S — CID 164610275
5-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]-3-methylthiophene-2-carbaldehyde (PubChem CID 164610275) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 5-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]-3-methylthiophene-2-carbaldehyde.
| Compound Name | 5-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]-3-methylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 164610275 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 5-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]-3-methylthiophene-2-carbaldehyde |
| SMILES | Cc1cc(-c2cncc(Cl)c2N2CCC3(CCNC3=O)CC2)sc1C=O |
| InChI | InChI=1S/C19H20ClN3O2S/c1-12-8-15(26-16(12)11-24)13-9-21-10-14(20)17(13)23-6-3-19(4-7-23)2-5-22-18(19)25/h8-11H,2-7H2,1H3,(H,22,25) |
| InChIKey | VDWUISJUKGFLEU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|