About N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide
N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide (PubChem CID 164610288) has the molecular formula C18H22FN3OS
and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide.
Molecular Properties
| Compound Name | N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide |
| PubChem CID | 164610288 |
| Molecular Formula | C18H22FN3OS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide |
| SMILES | O=C(CCCN1CCCCC1)Nc1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H22FN3OS/c19-15-8-6-14(7-9-15)18-20-13-17(24-18)21-16(23)5-4-12-22-10-2-1-3-11-22/h6-9,13H,1-5,10-12H2,(H,21,23) |
| InChIKey | BWGYNDZATYUGOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide?
The IUPAC name of N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide (CID 164610288) is N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide.
What is the SMILES notation for N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide?
The canonical SMILES for N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide is O=C(CCCN1CCCCC1)Nc1cnc(-c2ccc(F)cc2)s1.
What is the InChIKey of N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide?
The InChIKey is BWGYNDZATYUGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22FN3OS/c19-15-8-6-14(7-9-15)18-20-13-17(24-18)21-16(23)5-4-12-22-10-2-1-3-11-22/h6-9,13H,1-5,10-12H2,(H,21,23).
What are the key properties of N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide?
N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide has a molecular weight of 347.46 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-piperidin-1-ylbutanamide is sourced from PubChem (CID 164610288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).