C20H20N4O2S — CID 164610329
[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-pyridin-4-yl-2,3-dihydroindol-1-yl)methanone (PubChem CID 164610329) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-pyridin-4-yl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-pyridin-4-yl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 164610329 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-pyridin-4-yl-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ncc(CNCCO)s1)N1CCc2c(-c3ccncc3)cccc21 |
| InChI | InChI=1S/C20H20N4O2S/c25-11-9-22-12-15-13-23-19(27-15)20(26)24-10-6-17-16(2-1-3-18(17)24)14-4-7-21-8-5-14/h1-5,7-8,13,22,25H,6,9-12H2 |
| InChIKey | UMRYYIIIGKMROF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|