C33H33FN6O3S — CID 164610357
(E)-3-[4-[5-(6-fluoro-3-pyridinyl)-2-[[1-[(4-methylsulfonylphenyl)methyl]piperidin-4-yl]amino]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile (PubChem CID 164610357) has the molecular formula C33H33FN6O3S and a molecular weight of 612.73 g/mol. Its IUPAC name is (E)-3-[4-[5-(6-fluoro-3-pyridinyl)-2-[[1-[(4-methylsulfonylphenyl)methyl]piperidin-4-yl]amino]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[5-(6-fluoro-3-pyridinyl)-2-[[1-[(4-methylsulfonylphenyl)methyl]piperidin-4-yl]amino]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 164610357 |
| Molecular Formula | C33H33FN6O3S |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (E)-3-[4-[5-(6-fluoro-3-pyridinyl)-2-[[1-[(4-methylsulfonylphenyl)methyl]piperidin-4-yl]amino]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(NC2CCN(Cc3ccc(S(C)(=O)=O)cc3)CC2)ncc1-c1ccc(F)nc1 |
| InChI | InChI=1S/C33H33FN6O3S/c1-22-17-25(5-4-14-35)18-23(2)31(22)43-32-29(26-8-11-30(34)36-19-26)20-37-33(39-32)38-27-12-15-40(16-13-27)21-24-6-9-28(10-7-24)44(3,41)42/h4-11,17-20,27H,12-13,15-16,21H2,1-3H3,(H,37,38,39)/b5-4+ |
| InChIKey | VHMZCQSXEBPVBS-SNAWJCMRSA-N |
| XLogP | 6.10 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|