C21H17F3N4 — CID 164610379
4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)-2-(trifluoromethyl)aniline (PubChem CID 164610379) has the molecular formula C21H17F3N4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 164610379 |
| Molecular Formula | C21H17F3N4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)-2-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(-c2nc3ccc4[nH]ncc4c3c3c2CCCC3)cc1C(F)(F)F |
| InChI | InChI=1S/C21H17F3N4/c22-21(23,24)15-9-11(5-6-16(15)25)20-13-4-2-1-3-12(13)19-14-10-26-28-17(14)7-8-18(19)27-20/h5-10H,1-4,25H2,(H,26,28) |
| InChIKey | JAKCZARPBQVUAP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|