About [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea
[2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea (PubChem CID 164610428) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea.
Molecular Properties
| Compound Name | [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea |
| PubChem CID | 164610428 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea |
| SMILES | CC(C)=CCc1c(O)c(/N=N/C(N)=S)c2ccccc2c1O |
| InChI | InChI=1S/C16H17N3O2S/c1-9(2)7-8-12-14(20)11-6-4-3-5-10(11)13(15(12)21)18-19-16(17)22/h3-7,20-21H,8H2,1-2H3,(H2,17,22)/b19-18+ |
| InChIKey | KUCSGLQNLZAAQY-VHEBQXMUSA-N |
| XLogP | 4.09 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea?
The IUPAC name of [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea (CID 164610428) is [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea.
What is the SMILES notation for [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea?
The canonical SMILES for [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea is CC(C)=CCc1c(O)c(/N=N/C(N)=S)c2ccccc2c1O.
What is the InChIKey of [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea?
The InChIKey is KUCSGLQNLZAAQY-VHEBQXMUSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-9(2)7-8-12-14(20)11-6-4-3-5-10(11)13(15(12)21)18-19-16(17)22/h3-7,20-21H,8H2,1-2H3,(H2,17,22)/b19-18+.
What are the key properties of [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea?
[2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea has a molecular weight of 315.40 g/mol, XLogP of 4.09, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dihydroxy-3-(3-methylbut-2-enyl)naphthalen-1-yl]iminothiourea is sourced from PubChem (CID 164610428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).