C33H27N7O2 — CID 164610599
(E)-3-[2-(4-cyanoanilino)-4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 164610599) has the molecular formula C33H27N7O2 and a molecular weight of 553.63 g/mol. Its IUPAC name is (E)-3-[2-(4-cyanoanilino)-4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(4-cyanoanilino)-4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 164610599 |
| Molecular Formula | C33H27N7O2 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | (E)-3-[2-(4-cyanoanilino)-4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)ncc1/C=C/C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C33H27N7O2/c1-21-15-24(18-35)16-22(2)31(21)42-32-26(20-38-33(40-32)39-27-10-7-23(17-34)8-11-27)9-12-30(41)36-14-13-25-19-37-29-6-4-3-5-28(25)29/h3-12,15-16,19-20,37H,13-14H2,1-2H3,(H,36,41)(H,38,39,40)/b12-9+ |
| InChIKey | SBJXAMALFHHVIM-FMIVXFBMSA-N |
| XLogP | 6.23 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|