C36H42N6O4S — CID 164610633
(16E)-11,22-dioxa-44-thia-2,30,32,33,40,41-hexazapentacyclo[37.2.2.123,27.131,34.05,10]pentatetraconta-1(41),5,7,9,16,23,25,27(45),31,33,39,42-dodecaene-3,29-dione (PubChem CID 164610633) has the molecular formula C36H42N6O4S and a molecular weight of 654.84 g/mol. Its IUPAC name is (16E)-11,22-dioxa-44-thia-2,30,32,33,40,41-hexazapentacyclo[37.2.2.123,27.131,34.05,10]pentatetraconta-1(41),5,7,9,16,23,25,27(45),31,33,39,42-dodecaene-3,29-dione.
| Compound Name | (16E)-11,22-dioxa-44-thia-2,30,32,33,40,41-hexazapentacyclo[37.2.2.123,27.131,34.05,10]pentatetraconta-1(41),5,7,9,16,23,25,27(45),31,33,39,42-dodecaene-3,29-dione |
|---|---|
| PubChem CID | 164610633 |
| Molecular Formula | C36H42N6O4S |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | (16E)-11,22-dioxa-44-thia-2,30,32,33,40,41-hexazapentacyclo[37.2.2.123,27.131,34.05,10]pentatetraconta-1(41),5,7,9,16,23,25,27(45),31,33,39,42-dodecaene-3,29-dione |
| SMILES | O=C1Cc2ccccc2OCCCC/C=C/CCCCOc2cccc(c2)CC(=O)Nc2nnc(s2)CCCCc2ccc(nn2)N1 |
| InChI | InChI=1S/C36H42N6O4S/c43-33-25-27-14-13-17-30(24-27)45-22-11-5-3-1-2-4-6-12-23-46-31-18-9-7-15-28(31)26-34(44)37-32-21-20-29(39-40-32)16-8-10-19-35-41-42-36(38-33)47-35/h1-2,7,9,13-15,17-18,20-21,24H,3-6,8,10-12,16,19,22-23,25-26H2,(H,37,40,44)(H,38,42,43)/b2-1+ |
| InChIKey | TWIVGQHUXKCVAJ-OWOJBTEDSA-N |
| XLogP | 6.92 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|