About (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol
(5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol (PubChem CID 164610642) has the molecular formula C23H42OSi
and a molecular weight of 362.67 g/mol. Its IUPAC name is (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol.
Molecular Properties
| Compound Name | (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol |
| PubChem CID | 164610642 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol |
| SMILES | CCCCCCCCC[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42OSi/c1-8-9-10-11-12-13-14-17-23(24)18-15-16-19-25(20(2)3,21(4)5)22(6)7/h20-24H,8-14,17H2,1-7H3/t23-/m1/s1 |
| InChIKey | CLLXYEPQYHPIHN-HSZRJFAPSA-N |
| XLogP | 6.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol?
The IUPAC name of (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol (CID 164610642) is (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol.
What is the SMILES notation for (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol?
The canonical SMILES for (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol is CCCCCCCCC[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol?
The InChIKey is CLLXYEPQYHPIHN-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H42OSi/c1-8-9-10-11-12-13-14-17-23(24)18-15-16-19-25(20(2)3,21(4)5)22(6)7/h20-24H,8-14,17H2,1-7H3/t23-/m1/s1.
What are the key properties of (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol?
(5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol has a molecular weight of 362.67 g/mol, XLogP of 6.71, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-tri(propan-2-yl)silyltetradeca-1,3-diyn-5-ol is sourced from PubChem (CID 164610642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).