C28H26Cl2N4O3 — CID 164610673
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-ethyl-3-methylphenyl]prop-2-enamide (PubChem CID 164610673) has the molecular formula C28H26Cl2N4O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-ethyl-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-ethyl-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164610673 |
| Molecular Formula | C28H26Cl2N4O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-ethyl-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CC)cc(C)c1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C28H26Cl2N4O3/c1-6-16-10-15(3)27(20(11-16)32-23(35)7-2)34-28-31-14-18-12-17(8-9-19(18)33-28)24-25(29)21(36-4)13-22(37-5)26(24)30/h7-14H,2,6H2,1,3-5H3,(H,32,35)(H,31,33,34) |
| InChIKey | PHFYCMIWLVIHDW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|