About 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol
2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol (PubChem CID 164610741) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol.
Molecular Properties
| Compound Name | 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol |
| PubChem CID | 164610741 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol |
| SMILES | C/C(=N\Nc1nc2ccccc2s1)c1cc(OCCO)ccn1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11(14-10-12(6-7-17-14)22-9-8-21)19-20-16-18-13-4-2-3-5-15(13)23-16/h2-7,10,21H,8-9H2,1H3,(H,18,20)/b19-11+ |
| InChIKey | ODVZVWKRGMWCIG-YBFXNURJSA-N |
| XLogP | 2.90 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol?
The IUPAC name of 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol (CID 164610741) is 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol.
What is the SMILES notation for 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol?
The canonical SMILES for 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol is C/C(=N\Nc1nc2ccccc2s1)c1cc(OCCO)ccn1.
What is the InChIKey of 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol?
The InChIKey is ODVZVWKRGMWCIG-YBFXNURJSA-N. The full InChI is InChI=1S/C16H16N4O2S/c1-11(14-10-12(6-7-17-14)22-9-8-21)19-20-16-18-13-4-2-3-5-15(13)23-16/h2-7,10,21H,8-9H2,1H3,(H,18,20)/b19-11+.
What are the key properties of 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol?
2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol has a molecular weight of 328.40 g/mol, XLogP of 2.90, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]-4-pyridinyl]oxy]ethanol is sourced from PubChem (CID 164610741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).