C28H29NO5 — CID 164610868
[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-(5-methyl-2-oxo-1-pyridinyl)benzoate (PubChem CID 164610868) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-(5-methyl-2-oxo-1-pyridinyl)benzoate.
| Compound Name | [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-(5-methyl-2-oxo-1-pyridinyl)benzoate |
|---|---|
| PubChem CID | 164610868 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-(5-methyl-2-oxo-1-pyridinyl)benzoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CC[C@@H](OC(=O)c4ccc(-n5cc(C)ccc5=O)cc4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C28H29NO5/c1-16-5-12-23(30)29(15-16)20-9-7-19(8-10-20)27(32)33-22-11-6-17(2)24-25-21(13-14-28(22,24)4)18(3)26(31)34-25/h5-10,12,15,21-22,24-25H,3,11,13-14H2,1-2,4H3/t21-,22+,24+,25-,28-/m0/s1 |
| InChIKey | IDMSZHFRHJMMIA-LURASQHTSA-N |
| XLogP | 4.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|