About 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride
7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride (PubChem CID 164610888) has the molecular formula C12H12Cl2N2
and a molecular weight of 255.15 g/mol. Its IUPAC name is 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride.
Molecular Properties
| Compound Name | 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride |
| PubChem CID | 164610888 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride |
| SMILES | Cl.Nc1c2c(nc3ccc(Cl)cc13)CCC2 |
| InChI | InChI=1S/C12H11ClN2.ClH/c13-7-4-5-11-9(6-7)12(14)8-2-1-3-10(8)15-11;/h4-6H,1-3H2,(H2,14,15);1H |
| InChIKey | VWEQVGPZYVMENA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The IUPAC name of 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride (CID 164610888) is 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride.
What is the SMILES notation for 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The canonical SMILES for 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride is Cl.Nc1c2c(nc3ccc(Cl)cc13)CCC2.
What is the InChIKey of 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The InChIKey is VWEQVGPZYVMENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2.ClH/c13-7-4-5-11-9(6-7)12(14)8-2-1-3-10(8)15-11;/h4-6H,1-3H2,(H2,14,15);1H.
What are the key properties of 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride has a molecular weight of 255.15 g/mol, XLogP of 3.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride is sourced from PubChem (CID 164610888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).