C20H28O2 — CID 164610931
4-[(2R,5aS,9aS,9bS)-6,6,9a-trimethyl-2,3,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-yl]-2H-furan-5-one (PubChem CID 164610931) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 4-[(2R,5aS,9aS,9bS)-6,6,9a-trimethyl-2,3,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-yl]-2H-furan-5-one.
| Compound Name | 4-[(2R,5aS,9aS,9bS)-6,6,9a-trimethyl-2,3,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164610931 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 4-[(2R,5aS,9aS,9bS)-6,6,9a-trimethyl-2,3,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-2-yl]-2H-furan-5-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3C[C@@H](C4=CCOC4=O)CC3=CC[C@@H]12 |
| InChI | InChI=1S/C20H28O2/c1-19(2)8-4-9-20(3)16-12-14(15-7-10-22-18(15)21)11-13(16)5-6-17(19)20/h5,7,14,16-17H,4,6,8-12H2,1-3H3/t14-,16-,17-,20+/m0/s1 |
| InChIKey | YUEXBYMIQXTYJU-JWWIWJDOSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|