C33H37N7O2 — CID 164611038
(E)-N-[4-[(3R)-3-[[5-cyclopropyl-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 164611038) has the molecular formula C33H37N7O2 and a molecular weight of 563.71 g/mol. Its IUPAC name is (E)-N-[4-[(3R)-3-[[5-cyclopropyl-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[(3R)-3-[[5-cyclopropyl-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 164611038 |
| Molecular Formula | C33H37N7O2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | (E)-N-[4-[(3R)-3-[[5-cyclopropyl-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc(C(=O)N2CCC[C@@H](Nc3ncc(C4CC4)c(-c4c[nH]c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C33H37N7O2/c1-39(2)17-6-10-30(41)36-24-15-13-23(14-16-24)32(42)40-18-5-7-25(21-40)37-33-35-19-27(22-11-12-22)31(38-33)28-20-34-29-9-4-3-8-26(28)29/h3-4,6,8-10,13-16,19-20,22,25,34H,5,7,11-12,17-18,21H2,1-2H3,(H,36,41)(H,35,37,38)/b10-6+/t25-/m1/s1 |
| InChIKey | OMFQNPORJFLVAF-GZKVFJCDSA-N |
| XLogP | 5.28 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|