C26H31ClN6O5S — CID 164611080
4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide (PubChem CID 164611080) has the molecular formula C26H31ClN6O5S and a molecular weight of 575.09 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide.
| Compound Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 164611080 |
| Molecular Formula | C26H31ClN6O5S |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)NCCCCCC(=O)NO)cc2)ncc1Cl |
| InChI | InChI=1S/C26H31ClN6O5S/c1-17(2)39(37,38)22-9-6-5-8-21(22)31-24-20(27)16-29-26(32-24)30-19-13-11-18(12-14-19)25(35)28-15-7-3-4-10-23(34)33-36/h5-6,8-9,11-14,16-17,36H,3-4,7,10,15H2,1-2H3,(H,28,35)(H,33,34)(H2,29,30,31,32) |
| InChIKey | OZXIMBZQYMYQDK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|