C26H26N8O4 — CID 164611139
N-[3-[[2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 164611139) has the molecular formula C26H26N8O4 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164611139 |
| Molecular Formula | C26H26N8O4 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[3-[[2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c([N+](=O)[O-])c3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C26H26N8O4/c1-3-23(35)28-17-5-4-6-19(15-17)38-25-20-9-10-27-24(20)30-26(31-25)29-18-7-8-21(22(16-18)34(36)37)33-13-11-32(2)12-14-33/h3-10,15-16H,1,11-14H2,2H3,(H,28,35)(H2,27,29,30,31) |
| InChIKey | OQKZCHBURWTIEB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|