C17H21F3N6OS — CID 164611143
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(2,2,2-trifluoro-1-phenylethyl)urea (PubChem CID 164611143) has the molecular formula C17H21F3N6OS and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(2,2,2-trifluoro-1-phenylethyl)urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(2,2,2-trifluoro-1-phenylethyl)urea |
|---|---|
| PubChem CID | 164611143 |
| Molecular Formula | C17H21F3N6OS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(2,2,2-trifluoro-1-phenylethyl)urea |
| SMILES | Cc1nc(N)sc1CCC/N=C(\N)NC(=O)NC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N6OS/c1-10-12(28-15(22)24-10)8-5-9-23-14(21)26-16(27)25-13(17(18,19)20)11-6-3-2-4-7-11/h2-4,6-7,13H,5,8-9H2,1H3,(H2,22,24)(H4,21,23,25,26,27) |
| InChIKey | YJTHKEYGLMPNKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|