About N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide
N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide (PubChem CID 164611173) has the molecular formula C26H37N3O2
and a molecular weight of 423.60 g/mol. Its IUPAC name is N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide |
| PubChem CID | 164611173 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)Nc1ccc(C(=O)NC4CCCCC4)cc1)(C3)C2 |
| InChI | InChI=1S/C26H37N3O2/c1-24-12-18-13-25(2,15-24)17-26(14-18,16-24)29-23(31)28-21-10-8-19(9-11-21)22(30)27-20-6-4-3-5-7-20/h8-11,18,20H,3-7,12-17H2,1-2H3,(H,27,30)(H2,28,29,31) |
| InChIKey | PRLWTFJRGVXVMT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide?
The IUPAC name of N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide (CID 164611173) is N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide.
What is the SMILES notation for N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide?
The canonical SMILES for N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide is CC12CC3CC(C)(C1)CC(NC(=O)Nc1ccc(C(=O)NC4CCCCC4)cc1)(C3)C2.
What is the InChIKey of N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide?
The InChIKey is PRLWTFJRGVXVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37N3O2/c1-24-12-18-13-25(2,15-24)17-26(14-18,16-24)29-23(31)28-21-10-8-19(9-11-21)22(30)27-20-6-4-3-5-7-20/h8-11,18,20H,3-7,12-17H2,1-2H3,(H,27,30)(H2,28,29,31).
What are the key properties of N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide?
N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide has a molecular weight of 423.60 g/mol, XLogP of 5.62, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]benzamide is sourced from PubChem (CID 164611173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).