C15H21FN4O — CID 164611191
2-[[(1R,2S)-2-(6-fluoro-3-pyridinyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 164611191) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-(6-fluoro-3-pyridinyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[(1R,2S)-2-(6-fluoro-3-pyridinyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 164611191 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[[(1R,2S)-2-(6-fluoro-3-pyridinyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CN[C@@H]2C[C@H]2c2ccc(F)nc2)CC1 |
| InChI | InChI=1S/C15H21FN4O/c1-19-4-6-20(7-5-19)15(21)10-17-13-8-12(13)11-2-3-14(16)18-9-11/h2-3,9,12-13,17H,4-8,10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | LILBWONNSUGTNM-QWHCGFSZSA-N |
| XLogP | 0.44 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|