2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid

C19H18N2O2 — CID 164611198

IUPAC2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cnn3ccccc23)cc1C1CCCC1
InChIInChI=1S/C19H18N2O2/c22-19(23)15-9-8-14(11-16(15)13-5-1-2-6-13)17-12-20-21-10-4-3-7-18(17)21/h3-4,7-13H,1-2,5-6H2,(H,22,23)
InChIKeyFXDMIDQXZVLPIP-UHFFFAOYSA-N
MW306.37 g/mol
LogP4.36
Rot. Bonds3

About 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid

2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid (PubChem CID 164611198) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid.

Molecular Properties

Compound Name2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid
PubChem CID164611198
Molecular FormulaC19H18N2O2
Molecular Weight306.37 g/mol
Exact Mass306.14
IUPAC Name2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cnn3ccccc23)cc1C1CCCC1
InChIInChI=1S/C19H18N2O2/c22-19(23)15-9-8-14(11-16(15)13-5-1-2-6-13)17-12-20-21-10-4-3-7-18(17)21/h3-4,7-13H,1-2,5-6H2,(H,22,23)
InChIKeyFXDMIDQXZVLPIP-UHFFFAOYSA-N
XLogP4.36
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.37
LogP ≤ 54.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid?
The IUPAC name of 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid (CID 164611198) is 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid.
What is the SMILES notation for 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid?
The canonical SMILES for 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid is O=C(O)c1ccc(-c2cnn3ccccc23)cc1C1CCCC1.
What is the InChIKey of 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid?
The InChIKey is FXDMIDQXZVLPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c22-19(23)15-9-8-14(11-16(15)13-5-1-2-6-13)17-12-20-21-10-4-3-7-18(17)21/h3-4,7-13H,1-2,5-6H2,(H,22,23).
What are the key properties of 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid?
2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid has a molecular weight of 306.37 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-4-pyrazolo[1,5-a]pyridin-3-ylbenzoic acid is sourced from PubChem (CID 164611198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).