C17H21N5O4 — CID 164611201
4-[[4-(3-carboxypropylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]butanoic acid (PubChem CID 164611201) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[[4-(3-carboxypropylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[4-(3-carboxypropylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 164611201 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[[4-(3-carboxypropylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc(NCCCC(=O)O)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H21N5O4/c23-13(24)8-4-10-18-16-20-15(12-6-2-1-3-7-12)21-17(22-16)19-11-5-9-14(25)26/h1-3,6-7H,4-5,8-11H2,(H,23,24)(H,25,26)(H2,18,19,20,21,22) |
| InChIKey | RSGDWYIUAZGFIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|