About N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide
N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide (PubChem CID 164611216) has the molecular formula C22H36N2O2
and a molecular weight of 360.54 g/mol. Its IUPAC name is N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide |
| PubChem CID | 164611216 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)CCC(=O)NC1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C22H36N2O2/c1-20-10-16-11-21(2,13-20)15-22(12-16,14-20)24-19(26)9-8-18(25)23-17-6-4-3-5-7-17/h16-17H,3-15H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | CEUGSHDHZNEORW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide?
The IUPAC name of N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide (CID 164611216) is N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide.
What is the SMILES notation for N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide?
The canonical SMILES for N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide is CC12CC3CC(C)(C1)CC(NC(=O)CCC(=O)NC1CCCCC1)(C3)C2.
What is the InChIKey of N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide?
The InChIKey is CEUGSHDHZNEORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O2/c1-20-10-16-11-21(2,13-20)15-22(12-16,14-20)24-19(26)9-8-18(25)23-17-6-4-3-5-7-17/h16-17H,3-15H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide?
N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide has a molecular weight of 360.54 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-(3,5-dimethyl-1-adamantyl)butanediamide is sourced from PubChem (CID 164611216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).