C30H39ClN4O2 — CID 164611297
4-[9-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]nonanoyl]piperazin-2-one (PubChem CID 164611297) has the molecular formula C30H39ClN4O2 and a molecular weight of 523.12 g/mol. Its IUPAC name is 4-[9-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]nonanoyl]piperazin-2-one.
| Compound Name | 4-[9-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]nonanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 164611297 |
| Molecular Formula | C30H39ClN4O2 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 4-[9-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]nonanoyl]piperazin-2-one |
| SMILES | CC1=CC2Cc3nc4cc(Cl)ccc4c(NCCCCCCCCC(=O)N4CCNC(=O)C4)c3C(C1)C2 |
| InChI | InChI=1S/C30H39ClN4O2/c1-20-14-21-16-22(15-20)29-26(17-21)34-25-18-23(31)9-10-24(25)30(29)33-11-7-5-3-2-4-6-8-28(37)35-13-12-32-27(36)19-35/h9-10,14,18,21-22H,2-8,11-13,15-17,19H2,1H3,(H,32,36)(H,33,34) |
| InChIKey | ZBIXRKNNTMNYEM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|